What is the molecular formula of 2,4-Dimethylimidazole?
The molecular formula of 2,4-Dimethylimidazole is C5H8N2.
What is the molecular weight of 2,4-Dimethylimidazole?
The molecular weight of 2,4-Dimethylimidazole is 96.13 g/mol.
What is the IUPAC name of 2,4-Dimethylimidazole?
The IUPAC name of 2,4-Dimethylimidazole is 2,5-dimethyl-1H-imidazole.
What is the InChI of 2,4-Dimethylimidazole?
The InChI of 2,4-Dimethylimidazole is InChI=1S/C5H8N2/c1-4-3-6-5(2)7-4/h3H,1-2H3,(H,6,7).
What is the InChIKey of 2,4-Dimethylimidazole?
The InChIKey of 2,4-Dimethylimidazole is LLPKQRMDOFYSGZ-UHFFFAOYSA-N.
What is the canonical SMILES representation of 2,4-Dimethylimidazole?
The canonical SMILES representation of 2,4-Dimethylimidazole is CC1=CN=C(N1)C.
What is the CAS number of 2,4-Dimethylimidazole?
The CAS number of 2,4-Dimethylimidazole is 930-62-1.
What is the European Community (EC) number of 2,4-Dimethylimidazole?
The European Community (EC) number of 2,4-Dimethylimidazole is 213-221-4.
What is the UNII number of 2,4-Dimethylimidazole?
The UNII number of 2,4-Dimethylimidazole is T0MIX7SJ2E.