What is the molecular formula of phenyl benzoate?
The molecular formula of phenyl benzoate is C13H10O2.
What is the molecular weight of phenyl benzoate?
The molecular weight of phenyl benzoate is 198.22 g/mol.
What is the IUPAC name of phenyl benzoate?
The IUPAC name of phenyl benzoate is phenyl benzoate.
What is the InChI of phenyl benzoate?
The InChI of phenyl benzoate is InChI=1S/C13H10O2/c14-13(11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10H.
What is the InChIKey of phenyl benzoate?
The InChIKey of phenyl benzoate is FCJSHPDYVMKCHI-UHFFFAOYSA-N.
What is the canonical SMILES of phenyl benzoate?
The canonical SMILES of phenyl benzoate is C1=CC=C(C=C1)C(=O)OC2=CC=CC=C2.
What is the CAS number of phenyl benzoate?
The CAS number of phenyl benzoate is 93-99-2.
What is the European Community (EC) number of phenyl benzoate?
The European Community (EC) number of phenyl benzoate is 202-293-2.
What is the ChEMBL ID of phenyl benzoate?
The ChEMBL ID of phenyl benzoate is CHEMBL1885870.
What is the XLogP3 value of phenyl benzoate?
The XLogP3 value of phenyl benzoate is 3.6.
Download
![3-AMINO-N-[5-OXO-1-(2,4,6-TRICHLORO-PHENYL)-2,5-DIHYDRO-1H-PYRAZOL-3-YL]-BENZAMIDE](https://resource.alfa-chemistry.com/structure/939889-30-2.gif)
![5,7-Dichloro-1-methyl-1H-pyrazolo[4,3-d]pyrimidine](https://resource.alfa-chemistry.com/structure/939979-32-5.gif)
![[1-[(3,4-Dimethyl-1,2-oxazol-5-yl)amino]-3-methyl-1-oxobutan-2-yl]-dimethylazanium;2,4,6-trinitrophenolate](https://resource.alfa-chemistry.com/structure/93997-93-4.gif)
