The molecular formula of the compound is C7H8ClNO.
What are the synonyms of the compound?
The synonyms of the compound are 4-chloro-2-methoxyaniline, Benzenamine, 4-chloro-2-methoxy-, 4-Chloro-2-methoxy-phenylamine, and 4-Chloro-o-anisidine.
What is the molecular weight of the compound?
The molecular weight of the compound is 157.60 g/mol.
When was the compound created?
The compound was created on August 8, 2005.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 4-chloro-2-methoxyaniline.
What is the InChI code of the compound?
The InChI code of the compound is InChI=1S/C7H8ClNO/c1-10-7-4-5(8)2-3-6(7)9/h2-4H,9H2,1H3.
What is the InChIKey of the compound?
The InChIKey of the compound is WOXLPNAOCCIZGP-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is COC1=C(C=CC(=C1)Cl)N.
What is the CAS number of the compound?
The CAS number of the compound is 93-50-5.
Does the compound have a defined bond stereocenter count?
No, the compound does not have a defined bond stereocenter count.
※ Please kindly note that our products are for research use only.