What is the molecular formula of 2,5-Dimethylbenzylamine?
The molecular formula of 2,5-Dimethylbenzylamine is C9H13N.
What is the molecular weight of 2,5-Dimethylbenzylamine?
The molecular weight of 2,5-Dimethylbenzylamine is 135.21 g/mol.
What is the IUPAC name of 2,5-Dimethylbenzylamine?
The IUPAC name of 2,5-Dimethylbenzylamine is (2,5-dimethylphenyl)methanamine.
What is the InChI of 2,5-Dimethylbenzylamine?
The InChI of 2,5-Dimethylbenzylamine is InChI=1S/C9H13N/c1-7-3-4-8(2)9(5-7)6-10/h3-5H,6,10H2,1-2H3.
What is the InChIKey of 2,5-Dimethylbenzylamine?
The InChIKey of 2,5-Dimethylbenzylamine is LUJNPFWZXIGIPS-UHFFFAOYSA-N.
What is the canonical SMILES of 2,5-Dimethylbenzylamine?
The canonical SMILES of 2,5-Dimethylbenzylamine is CC1=CC(=C(C=C1)C)CN.
What is the CAS number of 2,5-Dimethylbenzylamine?
The CAS number of 2,5-Dimethylbenzylamine is 93-48-1.
What is the European Community (EC) number of 2,5-Dimethylbenzylamine?
The European Community (EC) number of 2,5-Dimethylbenzylamine is 202-250-8.
What is the UNII of 2,5-Dimethylbenzylamine?
The UNII of 2,5-Dimethylbenzylamine is 347CK3BPQ3.
Is 2,5-Dimethylbenzylamine a canonicalized compound?
Yes, 2,5-Dimethylbenzylamine is a canonicalized compound.