What is the molecular formula of 2-naphthoic acid?
The molecular formula of 2-naphthoic acid is C11H8O2.
How much does 2-naphthoic acid weigh?
The molecular weight of 2-naphthoic acid is 172.18 g/mol.
What is the IUPAC name of 2-naphthoic acid?
The IUPAC name of 2-naphthoic acid is naphthalene-2-carboxylic acid.
What is the InChI key of 2-naphthoic acid?
The InChI key of 2-naphthoic acid is UOBYKYZJUGYBDK-UHFFFAOYSA-N.
What is the canonical SMILES of 2-naphthoic acid?
The canonical SMILES of 2-naphthoic acid is C1=CC=C2C=C(C=CC2=C1)C(=O)O.
What is the CAS number of 2-naphthoic acid?
The CAS number of 2-naphthoic acid is 93-09-4.
What is the European Community (EC) number of 2-naphthoic acid?
The European Community (EC) number of 2-naphthoic acid is 202-217-8.
What is the ChEMBL ID of 2-naphthoic acid?
The ChEMBL ID of 2-naphthoic acid is CHEMBL114648.
What is the UNII of 2-naphthoic acid?
The UNII of 2-naphthoic acid is QLG01V0W2L.
What is the XLogP3 value of 2-naphthoic acid?
The XLogP3 value of 2-naphthoic acid is 3.3.