What is the PubChem CID of methyl cycloheptylideneacetate?
The PubChem CID of methyl cycloheptylideneacetate is 7006658.
What is the molecular formula of methyl cycloheptylideneacetate?
The molecular formula of methyl cycloheptylideneacetate is C10H16O2.
What are the synonyms for methyl cycloheptylideneacetate?
The synonyms for methyl cycloheptylideneacetate are methyl 2-cycloheptylideneacetate, 92984-49-1, METHYL CYCLOHEPTYLIDENEACETATE, methyl2-cycloheptylideneacetate, and SCHEMBL8089816.
What is the molecular weight of methyl cycloheptylideneacetate?
The molecular weight of methyl cycloheptylideneacetate is 168.23 g/mol.
What is the IUPAC name of methyl cycloheptylideneacetate?
The IUPAC name of methyl cycloheptylideneacetate is methyl 2-cycloheptylideneacetate.
What is the InChI of methyl cycloheptylideneacetate?
The InChI of methyl cycloheptylideneacetate is InChI=1S/C10H16O2/c1-12-10(11)8-9-6-4-2-3-5-7-9/h8H,2-7H2,1H3.
What is the InChIKey of methyl cycloheptylideneacetate?
The InChIKey of methyl cycloheptylideneacetate is BQKJZAQJFOUASE-UHFFFAOYSA-N.
What is the canonical SMILES representation of methyl cycloheptylideneacetate?
The canonical SMILES representation of methyl cycloheptylideneacetate is COC(=O)C=C1CCCCCC1.
What is the CAS number of methyl cycloheptylideneacetate?
The CAS number of methyl cycloheptylideneacetate is 92984-49-1.
Is methyl cycloheptylideneacetate a canonicalized compound?
Yes, methyl cycloheptylideneacetate is a canonicalized compound.
※ Please kindly note that our products are for research use only.