The molecular formula of the compound is C29H29ClN2O.
What is the molecular weight of the compound?
The molecular weight of the compound is 457.0 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-(3,3-diphenylpropylamino)-N,N-diphenylacetamide hydrochloride.
What is the InChI code of the compound?
The InChI code of the compound is "InChI=1S/C29H28N2O.ClH/c32-29(31(26-17-9-3-10-18-26)27-19-11-4-12-20-27)23-30-22-21-28(24-13-5-1-6-14-24)25-15-7-2-8-16-25;/h1-20,28,30H,21-23H2;1H".
What is the InChIKey of the compound?
The InChIKey of the compound is "ZPXKZTFECIUDRQ-UHFFFAOYSA-N".
What is the canonical SMILES representation of the compound?
The canonical SMILES representation of the compound is "C1=CC=C(C=C1)C(CCNCC(=O)N(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4.Cl".
How many hydrogen bond donor atoms does the compound have?
The compound has 2 hydrogen bond donor atoms.
How many hydrogen bond acceptor atoms does the compound have?
The compound has 2 hydrogen bond acceptor atoms.
How many rotatable bonds does the compound have?
The compound has 9 rotatable bonds.
Is the compound canonicalized?
Yes, the compound is canonicalized.
※ Please kindly note that our products are for research use only.