The molecular formula of the compound is C6H5NO2S.
What are the synonyms of the compound?
The synonyms of the compound are 6-Mercaptonicotinic acid, 92823-43-3, 17624-07-6, 6-Mercaptopyridine-3-carboxylic acid, and 6-sulfanylidene-1H-pyridine-3-carboxylic acid.
What is the molecular weight of the compound?
The molecular weight of the compound is 155.18 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 6-sulfanylidene-1H-pyridine-3-carboxylic acid.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C6H5NO2S/c8-6(9)4-1-2-5(10)7-3-4/h1-3H,(H,7,10)(H,8,9).
What is the InChIKey of the compound?
The InChIKey of the compound is JWWGTYCXARQFOT-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CC(=S)NC=C1C(=O)O.
What is the CAS number of the compound?
The CAS number of the compound is 17624-07-6.
What is the Hydrogen Bond Donor Count of the compound?
The Hydrogen Bond Donor Count of the compound is 2.
Is the compound canonicalized?
Yes, the compound is canonicalized.
※ Please kindly note that our products are for research use only.