What is the molecular formula of 1,2-Ethanediyl dioleate?
The molecular formula of 1,2-Ethanediyl dioleate is C38H70O4.
What is the molecular weight of 1,2-Ethanediyl dioleate?
The molecular weight of 1,2-Ethanediyl dioleate is 591.0 g/mol.
What is the IUPAC name of 1,2-Ethanediyl dioleate?
The IUPAC name of 1,2-Ethanediyl dioleate is 2-[(Z)-octadec-9-enoyl]oxyethyl (Z)-octadec-9-enoate.
What is the InChI key of 1,2-Ethanediyl dioleate?
The InChI key of 1,2-Ethanediyl dioleate is NKSOSPOXQKNIKJ-CLFAGFIQSA-N.
What is the canonical SMILES of 1,2-Ethanediyl dioleate?
The canonical SMILES of 1,2-Ethanediyl dioleate is CCCCCCCCC=CCCCCCCCC(=O)OCCOC(=O)CCCCCCCC=CCCCCCCCC.
What is the CAS number of 1,2-Ethanediyl dioleate?
The CAS number of 1,2-Ethanediyl dioleate is 928-24-5.
What is the XLogP3-AA value of 1,2-Ethanediyl dioleate?
The XLogP3-AA value of 1,2-Ethanediyl dioleate is 15.
How many hydrogen bond donor counts does 1,2-Ethanediyl dioleate have?
1,2-Ethanediyl dioleate has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 1,2-Ethanediyl dioleate have?
1,2-Ethanediyl dioleate has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does 1,2-Ethanediyl dioleate have?
1,2-Ethanediyl dioleate has 35 rotatable bond counts.