What is the molecular formula of 2-Butenediamide?
The molecular formula of 2-Butenediamide is C4H6N2O2.
What is the molecular weight of 2-Butenediamide?
The molecular weight of 2-Butenediamide is 114.10 g/mol.
What is the IUPAC name of 2-Butenediamide?
The IUPAC name of 2-Butenediamide is (Z)-But-2-enediamide.
What is the InChI of 2-Butenediamide?
The InChI of 2-Butenediamide is InChI=1S/C4H6N2O2/c5-3(7)1-2-4(6)8/h1-2H,(H2,5,7)(H2,6,8)/b2-1-.
What is the InChIKey of 2-Butenediamide?
The InChIKey of 2-Butenediamide is BSSNZUFKXJJCBG-UPHRSURJSA-N.
What is the CAS number of 2-Butenediamide?
The CAS number of 2-Butenediamide is 928-01-8.
How many hydrogen bond donor count does 2-Butenediamide have?
2-Butenediamide has 2 hydrogen bond donor count.
How many hydrogen bond acceptor count does 2-Butenediamide have?
2-Butenediamide has 2 hydrogen bond acceptor count.
What is the topological polar surface area of 2-Butenediamide?
The topological polar surface area of 2-Butenediamide is 86.2 ?2.
How many rotatable bond count does 2-Butenediamide have?
2-Butenediamide has 2 rotatable bond count.