What is the molecular formula of Ethyl cyclopropylcarboxylate-d4?
The molecular formula is C6H10O2.
What are the synonyms for Ethyl cyclopropylcarboxylate-d4?
The synonyms are Ethyl Cyclopropylcarboxylate-d4, 927810-77-3, ethyl 2,2,3,3-tetradeuteriocyclopropane-1-carboxylate, and Ethyl (2,2,3,3-~2~H_4_)cyclopropanecarboxylate.
What is the molecular weight of Ethyl cyclopropylcarboxylate-d4?
The molecular weight is 118.17 g/mol.
When was Ethyl cyclopropylcarboxylate-d4 created and modified?
It was created on May 17, 2013, and last modified on December 30, 2023.
What is the IUPAC name of Ethyl cyclopropylcarboxylate-d4?
The IUPAC name is ethyl 2,2,3,3-tetradeuteriocyclopropane-1-carboxylate.
What is the InChI of Ethyl cyclopropylcarboxylate-d4?
The InChI is InChI=1S/C6H10O2/c1-2-8-6(7)5-3-4-5/h5H,2-4H2,1H3/i3D2,4D2.
What is the InChIKey of Ethyl cyclopropylcarboxylate-d4?
The InChIKey is LDDOSDVZPSGLFZ-KHORGVISSA-N.
What is the canonical SMILES of Ethyl cyclopropylcarboxylate-d4?
The canonical SMILES is CCOC(=O)C1CC1.
What is the CAS number of Ethyl cyclopropylcarboxylate-d4?
The CAS number is 927810-77-3.
※ Please kindly note that our products are for research use only.