The molecular formula of the compound is C15H21N3O6.
What is the molecular weight of the compound?
The molecular weight of the compound is 339.34 g/mol.
What are the synonyms of the compound?
The synonyms of the compound include ISOPHTHALAMIC ACID, N-(2-(DIETHYLAMINO)ETHYL)-6-HYDROXY-5-NITRO-, METHYL ESTER and methyl 3-(2-diethylaminoethylcarbamoyl)-4-hydroxy-5-nitrobenzoate.
When was the compound created?
The compound was created on August 8, 2005.
When was the compound last modified?
The compound was last modified on December 30, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is methyl 3-[2-(diethylamino)ethylcarbamoyl]-4-hydroxy-5-nitrobenzoate.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C15H21N3O6/c1-4-17(5-2)7-6-16-14(20)11-8-10(15(21)24-3)9-12(13(11)19)18(22)23/h8-9,19H,4-7H2,1-3H3,(H,16,20).
What is the InChIKey of the compound?
The InChIKey of the compound is VGIZFCODQYHHLZ-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CCN(CC)CCNC(=O)C1=C(C(=CC(=C1)C(=O)OC)[N+](=O)[O-])O.
What is the CAS number of the compound?
The CAS number of the compound is 92697-56-8.
※ Please kindly note that our products are for research use only.
Download
![4-[4-[(2-Bromophenyl)methyl]-1-piperazinyl]benzoic acid ethyl ester](https://resource.alfa-chemistry.com/structure/926934-01-2.gif)
![Acetic acid[2-[acetyl[2-[phenyl(methyl)amino]ethyl]amino]ethyl]ester](https://resource.alfa-chemistry.com/structure/92700-19-1.gif)
