What is the PubChem CID for cefminox?
PubChem CID 71141.
What is the molecular formula of cefminox?
The molecular formula of cefminox is C16H21N7O7S3.
What are the synonyms for cefminox?
The synonyms for cefminox include Cefminox, MT 141, cefminox sodium.
What is the molecular weight of cefminox?
The molecular weight of cefminox is 519.6 g/mol.
When was cefminox created?
Cefminox was created on August 8, 2005.
When was cefminox last modified?
Cefminox was last modified on December 30, 2023.
What is the IUPAC name of cefminox?
The IUPAC name of cefminox is (6R,7S)-7-[[2-[(2S)-2-amino-2-carboxyethyl]sulfanylacetyl]amino]-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
What is the InChIKey of cefminox?
The InChIKey of cefminox is JSDXOWVAHXDYCU-VXSYNFHWSA-N.
What is the canonical SMILES of cefminox?
The canonical SMILES of cefminox is CN1C(=NN=N1)SCC2=C(N3C(C(C3=O)(NC(=O)CSCC(C(=O)O)N)OC)SC2)C(=O)O.
What is the CAS number for cefminox?
The CAS number for cefminox is 84305-41-9.