What is the PubChem CID for pravadoline?
The PubChem CID for pravadoline is 56463.
What is the molecular formula of pravadoline?
The molecular formula of pravadoline is C23H26N2O3.
What are some synonyms for pravadoline?
Some synonyms for pravadoline are 4-Methoxyphenyl)(2-methyl-1-(2-morpholinoethyl)-1H-indol-3-yl)methanone and WIN 48098.
What is the molecular weight of pravadoline?
The molecular weight of pravadoline is 378.5 g/mol.
When was pravadoline created and modified?
Pravadoline was created on 2005-08-08 and modified on 2023-12-30.
What is the IUPAC name of pravadoline?
The IUPAC name of pravadoline is (4-methoxyphenyl)-[2-methyl-1-(2-morpholin-4-ylethyl)indol-3-yl]methanone.
What is the InChI of pravadoline?
The InChI of pravadoline is InChI=1S/C23H26N2O3/c1-17-22(23(26)18-7-9-19(27-2)10-8-18)20-5-3-4-6-21(20)25(17)12-11-24-13-15-28-16-14-24/h3-10H,11-16H2,1-2H3.
What is the InChIKey of pravadoline?
The InChIKey of pravadoline is MEUQWHZOUDZXHH-UHFFFAOYSA-N.
What is the canonical SMILES of pravadoline?
The canonical SMILES of pravadoline is CC1=C(C2=CC=CC=C2N1CCN3CCOCC3)C(=O)C4=CC=C(C=C4)OC.
What is the CAS number for pravadoline?
The CAS number for pravadoline is 92623-83-1.
Download
![N-[Fluoro-(propan-2-ylamino)phosphinothioyl]propan-2-amine](https://resource.alfa-chemistry.com/structure/926-23-8.gif)
![leuco polysulfurised 4-[(2,4-dinitrophenyl)amino]phenol](https://resource.alfa-chemistry.com/structure/92623-81-9.gif)
