What is the molecular formula of H-Lys-amc?
The molecular formula of H-Lys-amc is C16H21N3O3.
What is the molecular weight of H-Lys-amc?
The molecular weight of H-Lys-amc is 303.36 g/mol.
What is the IUPAC name of H-Lys-amc?
The IUPAC name of H-Lys-amc is (2S)-2,6-diamino-N-(4-methyl-2-oxochromen-7-yl)hexanamide.
What is the InChI of H-Lys-amc?
The InChI of H-Lys-amc is InChI=1S/C16H21N3O3/c1-10-8-15(20)22-14-9-11(5-6-12(10)14)19-16(21)13(18)4-2-3-7-17/h5-6,8-9,13H,2-4,7,17-18H2,1H3,(H,19,21)/t13-/m0/s1.
What is the InChIKey of H-Lys-amc?
The InChIKey of H-Lys-amc is ZLBMFVYCTXDWPT-ZDUSSCGKSA-N.
What is the canonical SMILES of H-Lys-amc?
The canonical SMILES of H-Lys-amc is CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)C(CCCCN)N.
What is the isomeric SMILES of H-Lys-amc?
The isomeric SMILES of H-Lys-amc is CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@H](CCCCN)N.
What is the XLogP3 value of H-Lys-amc?
The XLogP3 value of H-Lys-amc is 0.7.
What is the hydrogen bond donor count of H-Lys-amc?
The hydrogen bond donor count of H-Lys-amc is 3.
What is the hydrogen bond acceptor count of H-Lys-amc?
The hydrogen bond acceptor count of H-Lys-amc is 5.