What is the PubChem CID of Pilocarpic acid sodium salt?
PubChem CID 71749484.
What is the molecular formula of Pilocarpic acid sodium salt?
The molecular formula is C11H17N2NaO3.
What are the synonyms for Pilocarpic acid sodium salt?
The synonyms are Isopilocarpic Acid Sodium Salt, Sodium Pilocarpate, Pilocarpic Acid Sodium Salt.
What is the molecular weight of Pilocarpic acid sodium salt?
The molecular weight is 248.25 g/mol.
What is the IUPAC name of Pilocarpic acid sodium salt?
The IUPAC name is sodium;(2R,3R)-2-ethyl-3-(hydroxymethyl)-4-(3-methylimidazol-4-yl)butanoate.
What is the InChI of Pilocarpic acid sodium salt?
The InChI of Pilocarpic acid sodium salt is InChI=1S/C11H18N2O3.Na/c1-3-10(11(15)16)8(6-14)4-9-5-12-7-13(9)2;/h5,7-8,10,14H,3-4,6H2,1-2H3,(H,15,16);/q;+1/p-1/t8-,10+;/m0./s1.
What is the InChIKey of Pilocarpic acid sodium salt?
The InChIKey is YGXGGGNCVNXKBE-KXNXZCPBSA-M.
What is the canonical SMILES of Pilocarpic acid sodium salt?
The canonical SMILES is CCC(C(CC1=CN=CN1C)CO)C(=O)[O-].[Na+].
What is the hydrogen bond donor count of Pilocarpic acid sodium salt?
The hydrogen bond donor count is 1.
Is Pilocarpic acid sodium salt a canonicalized compound?
Yes, Pilocarpic acid sodium salt is canonicalized.
※ Please kindly note that our products are for research use only.