The molecular formula of the compound is C13H12O3S.
What are the synonyms for the compound?
The synonyms for the compound are 925674-54-0, 5-(4-Methoxyphenyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine, Thieno[3,4-b]-1,4-dioxin,2,3-dihydro-5-(4-methoxyphenyl)-, SCHEMBL17713608, and DTXSID50718840.
What is the molecular weight of the compound?
The molecular weight of the compound is 248.30 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 5-(4-methoxyphenyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C13H12O3S/c1-14-10-4-2-9(3-5-10)13-12-11(8-17-13)15-6-7-16-12/h2-5,8H,6-7H2,1H3.
What is the InChIKey of the compound?
The InChIKey of the compound is XUQGMFYCGYHWKU-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is COC1=CC=C(C=C1)C2=C3C(=CS2)OCCO3.
What is the CAS number of the compound?
The CAS number of the compound is 925674-54-0.
What is the DSSTox Substance ID of the compound?
The DSSTox Substance ID of the compound is DTXSID50718840.
Is the compound considered canonicalized?
Yes, the compound is considered canonicalized.
※ Please kindly note that our products are for research use only.