What is the molecular formula of 4-Bromo-2-cyanobenzeneacetonitrile?
The molecular formula of 4-Bromo-2-cyanobenzeneacetonitrile is C9H5BrN2.
What are the synonyms for 4-Bromo-2-cyanobenzeneacetonitrile?
The synonyms for 4-Bromo-2-cyanobenzeneacetonitrile are 925672-89-5, 5-bromo-2-(cyanomethyl)benzonitrile, MFCD09999218, and Benzeneacetonitrile, 4-bromo-2-cyano-.
What is the molecular weight of 4-Bromo-2-cyanobenzeneacetonitrile?
The molecular weight of 4-Bromo-2-cyanobenzeneacetonitrile is 221.05 g/mol.
What is the IUPAC name of 4-Bromo-2-cyanobenzeneacetonitrile?
The IUPAC name of 4-Bromo-2-cyanobenzeneacetonitrile is 5-bromo-2-(cyanomethyl)benzonitrile.
What is the InChI of 4-Bromo-2-cyanobenzeneacetonitrile?
The InChI of 4-Bromo-2-cyanobenzeneacetonitrile is InChI=1S/C9H5BrN2/c10-9-2-1-7(3-4-11)8(5-9)6-12/h1-2,5H,3H2.
What is the InChIKey of 4-Bromo-2-cyanobenzeneacetonitrile?
The InChIKey of 4-Bromo-2-cyanobenzeneacetonitrile is JFJQZQISHKWUQJ-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-2-cyanobenzeneacetonitrile?
The canonical SMILES of 4-Bromo-2-cyanobenzeneacetonitrile is C1=CC(=C(C=C1Br)C#N)CC#N.
What is the CAS number of 4-Bromo-2-cyanobenzeneacetonitrile?
The CAS number of 4-Bromo-2-cyanobenzeneacetonitrile is 925672-89-5.
What is the molecular weight of 4-Bromo-2-cyanobenzeneacetonitrile according to PubChem?
The molecular weight of 4-Bromo-2-cyanobenzeneacetonitrile according to PubChem is 221.05 g/mol.
Is 4-Bromo-2-cyanobenzeneacetonitrile a canonicalized compound according to PubChem?
Yes, 4-Bromo-2-cyanobenzeneacetonitrile is a canonicalized compound according to PubChem.
※ Please kindly note that our products are for research use only.