What is the molecular formula of 2',6-Dihydroxyflavone?
The molecular formula of 2',6-Dihydroxyflavone is C15H10O4.
What is the molecular weight of 2',6-Dihydroxyflavone?
The molecular weight of 2',6-Dihydroxyflavone is 254.24 g/mol.
What is the IUPAC Name of 2',6-Dihydroxyflavone?
The IUPAC Name of 2',6-Dihydroxyflavone is 6-hydroxy-2-(2-hydroxyphenyl)chromen-4-one.
What is the InChI of 2',6-Dihydroxyflavone?
The InChI of 2',6-Dihydroxyflavone is InChI=1S/C15H10O4/c16-9-5-6-14-11(7-9)13(18)8-15(19-14)10-3-1-2-4-12(10)17/h1-8,16-17H.
What is the InChIKey of 2',6-Dihydroxyflavone?
The InChIKey of 2',6-Dihydroxyflavone is YCGXYGWBHFKQHY-UHFFFAOYSA-N.
What is the Canonical SMILES of 2',6-Dihydroxyflavone?
The Canonical SMILES of 2',6-Dihydroxyflavone is C1=CC=C(C(=C1)C2=CC(=O)C3=C(O2)C=CC(=C3)O)O.
What is the CAS number of 2',6-Dihydroxyflavone?
The CAS number of 2',6-Dihydoxyflavone is 92439-20-8.
What is the XLogP3 value of 2',6-Dihydroxyflavone?
The XLogP3 value of 2',6-Dihydroxyflavone is 3.3.
How many hydrogen bond donor counts does 2',6-Dihydroxyflavone have?
2',6-Dihydroxyflavone has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2',6-Dihydroxyflavone have?
2',6-Dihydroxyflavone has 4 hydrogen bond acceptor counts.