What is the molecular formula of Chembrdg-bb 5315095?
The molecular formula of Chembrdg-bb 5315095 is C15H9NO3S.
What is the molecular weight of Chembrdg-bb 5315095?
The molecular weight of Chembrdg-bb 5315095 is 283.3 g/mol.
When was Chembrdg-bb 5315095 created?
Chembrdg-bb 5315095 was created on July 8, 2005.
When was Chembrdg-bb 5315095 last modified?
Chembrdg-bb 5315095 was last modified on December 30, 2023.
What is the IUPAC name of Chembrdg-bb 5315095?
The IUPAC name of Chembrdg-bb 5315095 is (2E)-2-[(2-nitrophenyl)methylidene]-1-benzothiophen-3-one.
What is the InChI of Chembrdg-bb 5315095?
The InChI of Chembrdg-bb 5315095 is InChI=1S/C15H9NO3S/c17-15-11-6-2-4-8-13(11)20-14(15)9-10-5-1-3-7-12(10)16(18)19/h1-9H/b14-9+.
What is the InChIKey of Chembrdg-bb 5315095?
The InChIKey of Chembrdg-bb 5315095 is CXKLLLPQMSFRKN-NTEUORMPSA-N.
What is the canonical SMILES of Chembrdg-bb 5315095?
The canonical SMILES of Chembrdg-bb 5315095 is C1=CC=C(C(=C1)C=C2C(=O)C3=CC=CC=C3S2)[N+](=O)[O-].
What is the XLogP3-AA value of Chembrdg-bb 5315095?
The XLogP3-AA value of Chembrdg-bb 5315095 is 4.
Is Chembrdg-bb 5315095 the canonicalized compound?
Yes, Chembrdg-bb 5315095 is the canonicalized compound.