What is the molecular formula of 4-Oxoheptanoic acid?
The molecular formula of 4-Oxoheptanoic acid is C7H12O3.
What is the molecular weight of 4-Oxoheptanoic acid?
The molecular weight of 4-Oxoheptanoic acid is 144.17 g/mol.
When was 4-Oxoheptanoic acid created?
4-Oxoheptanoic acid was created on January 13, 2006.
What is the IUPAC name of 4-Oxoheptanoic acid?
The IUPAC name of 4-Oxoheptanoic acid is 4-oxoheptanoic acid.
What is the InChI of 4-Oxoheptanoic acid?
The InChI of 4-Oxoheptanoic acid is InChI=1S/C7H12O3/c1-2-3-6(8)4-5-7(9)10/h2-5H2,1H3,(H,9,10).
What is the Canonical SMILES of 4-Oxoheptanoic acid?
The Canonical SMILES of 4-Oxoheptanoic acid is CCCC(=O)CCC(=O)O.
What is the CAS number of 4-Oxoheptanoic acid?
The CAS number of 4-Oxoheptanoic acid is 924-97-0.
What is the XLogP3-AA value of 4-Oxoheptanoic acid?
The XLogP3-AA value of 4-Oxoheptanoic acid is 0.2.
How many hydrogen bond donor count does 4-Oxoheptanoic acid have?
4-Oxoheptanoic acid has 1 hydrogen bond donor count.
How many rotatable bond count does 4-Oxoheptanoic acid have?
4-Oxoheptanoic acid has 5 rotatable bond count.