What is the molecular formula of H-Gly-Ala-Tyr-OH?
The molecular formula of H-Gly-Ala-Tyr-OH is C14H19N3O5.
What are the synonyms of H-Gly-Ala-Tyr-OH?
The synonyms of H-Gly-Ala-Tyr-OH are GLY-ALA-TYR, 92327-84-9, and Glycyl-alanyl-tyrosine.
What is the molecular weight of H-Gly-Ala-Tyr-OH?
The molecular weight of H-Gly-Ala-Tyr-OH is 309.32 g/mol.
When was H-Gly-Ala-Tyr-OH created?
H-Gly-Ala-Tyr-OH was created on July 29, 2006.
When was H-Gly-Ala-Tyr-OH last modified?
H-Gly-Ala-Tyr-OH was last modified on December 30, 2023.
What is the IUPAC name of H-Gly-Ala-Tyr-OH?
The IUPAC name of H-Gly-Ala-Tyr-OH is (2S)-2-[[(2S)-2-[(2-aminoacetyl)amino]propanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
What is the InChI of H-Gly-Ala-Tyr-OH?
The InChI of H-Gly-Ala-Tyr-OH is InChI=1S/C14H19N3O5/c1-8(16-12(19)7-15)13(20)17-11(14(21)22)6-9-2-4-10(18)5-3-9/h2-5,8,11,18H,6-7,15H2,1H3,(H,16,19)(H,17,20)(H,21,22)/t8-,11-/m0/s1.
What is the InChIKey of H-Gly-Ala-Tyr-OH?
The InChIKey of H-Gly-Ala-Tyr-OH is QIZJOTQTCAGKPU-KWQFWETISA-N.
What is the canonical SMILES of H-Gly-Ala-Tyr-OH?
The canonical SMILES of H-Gly-Ala-Tyr-OH is CC(C(=O)NC(CC1=CC=C(C=C1)O)C(=O)O)NC(=O)CN.
What is the Metabolomics Workbench ID of H-Gly-Ala-Tyr-OH?
The Metabolomics Workbench ID of H-Gly-Ala-Tyr-OH is 81874.