What is the molecular formula of 2,2-Difluorocyclopentan-1-amine?
The molecular formula of 2,2-Difluorocyclopentan-1-amine is C5H9F2N.
What are the synonyms of 2,2-Difluorocyclopentan-1-amine?
The synonyms of 2,2-Difluorocyclopentan-1-amine are 921753-24-4, 2,2-Difluorocyclopentanamine, (1R)-2,2-difluorocyclopentanamine, (1S)-2,2-difluorocyclopentanamine, and more.
What is the molecular weight of 2,2-Difluorocyclopentan-1-amine?
The molecular weight of 2,2-Difluorocyclopentan-1-amine is 121.13 g/mol.
When was 2,2-Difluorocyclopentan-1-amine created?
2,2-Difluorocyclopentan-1-amine was created on August 5, 2011.
When was 2,2-Difluorocyclopentan-1-amine last modified?
The last modification date of 2,2-Difluorocyclopentan-1-amine is December 30, 2023.
What is the IUPAC name of 2,2-Difluorocyclopentan-1-amine?
The IUPAC name of 2,2-Difluorocyclopentan-1-amine is 2,2-difluorocyclopentan-1-amine.
What is the InChI of 2,2-Difluorocyclopentan-1-amine?
The InChI of 2,2-Difluorocyclopentan-1-amine is InChI=1S/C5H9F2N/c6-5(7)3-1-2-4(5)8/h4H,1-3,8H2.
What is the InChI key of 2,2-Difluorocyclopentan-1-amine?
The InChI key of 2,2-Difluorocyclopentan-1-amine is JBXAZJIGJLDLEM-UHFFFAOYSA-N.
What is the canonical SMILES of 2,2-Difluorocyclopentan-1-amine?
The canonical SMILES of 2,2-Difluorocyclopentan-1-amine is C1CC(C(C1)(F)F)N.
Does 2,2-Difluorocyclopentan-1-amine have a defined atom stereocenter count?
No, 2,2-Difluorocyclopentan-1-amine does not have a defined atom stereocenter count, as it is zero.
※ Please kindly note that our products are for research use only.
Download
