The molecular formula of the compound is C18H9F3N4O3.
What is the molecular weight of the compound?
The molecular weight of the compound is 386.3 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 5-(4-cyanophenoxy)-3-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-6-carboxylic acid.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C18H9F3N4O3/c19-18(20,21)12-3-1-2-11(8-12)15-23-16(14(17(26)27)24-25-15)28-13-6-4-10(9-22)5-7-13/h1-8H,(H,26,27).
What is the InChIKey of the compound?
The InChIKey of the compound is OMNPPFHKLNTKBS-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CC(=CC(=C1)C(F)(F)F)C2=NC(=C(N=N2)C(=O)O)OC3=CC=C(C=C3)C#N.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 3.2.
What is the hydrogen bond donor count of the compound?
The hydrogen bond donor count of the compound is 1.
What is the hydrogen bond acceptor count of the compound?
The hydrogen bond acceptor count of the compound is 10.
What is the rotatable bond count of the compound?
The rotatable bond count of the compound is 4.
※ Please kindly note that our products are for research use only.
Download
![5-Chloro-2-(4-methoxyphenyl)benzo[d]thiazole](https://resource.alfa-chemistry.com/structure/92161-46-1.gif)
![5-(4-Cyanophenoxy)-3-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-6-carboxylic acid ethyl ester](https://resource.alfa-chemistry.com/structure/921619-39-8.gif)
![5-(4-Chlorophenoxy)-N,N-diethyl-3-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-6-carboxamide](https://resource.alfa-chemistry.com/structure/921620-16-8.gif)
![5-(4-Chlorophenoxy)-N-phenyl-3-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-6-carboxamide](https://resource.alfa-chemistry.com/structure/921620-20-4.gif)
![5-(4-Cyanophenoxy)-3-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-6-carbonitrile](https://resource.alfa-chemistry.com/structure/921620-33-9.gif)
