What is the molecular formula of Almac b20550?
The molecular formula of Almac b20550 is C16H24N2O3.
When was Almac b20550 created and modified?
Almac b20550 was created on February 29, 2008, and modified on December 30, 2023.
What is the IUPAC name of Almac b20550?
The IUPAC name of Almac b20550 is tert-butyl 4-(2-cyclopropyl-1,3-oxazol-5-yl)piperidine-1-carboxylate.
What is the InChI of Almac b20550?
The InChI of Almac b20550 is InChI=1/C16H24N2O3/c1-16(2,3)21-15(19)18-8-6-11(7-9-18)13-10-17-14(20-13)12-4-5-12/h10-12H,4-9H2,1-3H3.
What is the InChIKey of Almac b20550?
The InChIKey of Almac b20550 is RCSQBGPSBZWDCL-UHFFFAOYSA-N.
What is the canonical SMILES of Almac b20550?
The canonical SMILES of Almac b20550 is CC(C)(C)OC(=O)N1CCC(CC1)C2=CN=C(O2)C3CC3.
What is the molecular weight of Almac b20550?
The molecular weight of Almac b20550 is 292.37 g/mol.
How many hydrogen bond donor counts does Almac b20550 have?
Almac b20550 has 0 hydrogen bond donor counts.
What is the XLogP3-AA value for Almac b20550?
The XLogP3-AA value for Almac b20550 is 2.4.
Is the compound canonicalized?
Yes, the compound is canonicalized.