The molecular formula of the compound is C9H11N3O3.
What are the synonyms of the compound?
The synonyms of the compound are (3R)-1-(5-nitropyridin-2-yl)pyrrolidin-3-ol, 921592-85-0, (R)-1-(5-nitropyridin-2-yl)pyrrolidin-3-ol, SCHEMBL4879305, DTXSID30740048.
What is the molecular weight of the compound?
The molecular weight of the compound is 209.20 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is (3R)-1-(5-nitropyridin-2-yl)pyrrolidin-3-ol.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C9H11N3O3/c13-8-3-4-11(6-8)9-2-1-7(5-10-9)12(14)15/h1-2,5,8,13H,3-4,6H2/t8-/m1/s1.
What is the InChIKey of the compound?
The InChIKey of the compound is USIKCAKKNZHNLC-MRVPVSSYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1CN(CC1O)C2=NC=C(C=C2)[N+](=O)[O-].
What is the isomeric SMILES of the compound?
The isomeric SMILES of the compound is C1CN(C[C@@H]1O)C2=NC=C(C=C2)[N+](=O)[O-].
What is the CAS identifier of the compound?
The CAS identifier of the compound is 921592-85-0.
Is the compound canonicalized?
Yes, the compound is canonicalized.
※ Please kindly note that our products are for research use only.