What is the molecular formula of (E)-Ceftriaxone?
The molecular formula of (E)-Ceftriaxone is C18H18N8O7S3.
What is the molecular weight of (E)-Ceftriaxone?
The molecular weight of (E)-Ceftriaxone is 554.6 g/mol.
What is the IUPAC name of (E)-Ceftriaxone?
The IUPAC name of (E)-Ceftriaxone is (6R,7R)-7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
What is the InChI of (E)-Ceftriaxone?
The InChI of (E)-Ceftriaxone is InChI=1S/C18H18N8O7S3/c1-25-18(22-12(28)13(29)23-25)36-4-6-3-34-15-9(14(30)26(15)10(6)16(31)32)21-11(27)8(24-33-2)7-5-35-17(19)20-7/h5,9,15H,3-4H2,1-2H3,(H2,19,20)(H,21,27)(H,23,29)(H,31,32)/b24-8+/t9-,15-/m1/s1.
What is the InChIKey of (E)-Ceftriaxone?
The InChIKey of (E)-Ceftriaxone is VAAUVRVFOQPIGI-TYHRLYECSA-N.
What is the canonical SMILES of (E)-Ceftriaxone?
The canonical SMILES of (E)-Ceftriaxone is CN1C(=NC(=O)C(=O)N1)SCC2=C(N3C(C(C3=O)NC(=O)C(=NOC)C4=CSC(=N4)N)SC2)C(=O)O.
What is the molecular weight of (E)-Ceftriaxone according to PubChem?
The molecular weight of (E)-Ceftriaxone according to PubChem is 554.6 g/mol.
What is the CAS number of (E)-Ceftriaxone?
The CAS number of (E)-Ceftriaxone is 73384-59-5.
What is the XLogP3 value of (E)-Ceftriaxone?
The XLogP3 value of (E)-Ceftriaxone is -1.3.
What is the hydrogen bond acceptor count of (E)-Ceftriaxone?
The hydrogen bond acceptor count of (E)-Ceftriaxone is 13.