What is the PubChem CID of vanillonitrile?
The PubChem CID of vanillonitrile is 78135.
What is the molecular formula of vanillonitrile?
The molecular formula of vanillonitrile is C8H7NO2.
What are some synonyms for vanillonitrile?
Some synonyms for vanillonitrile are 4-Hydroxy-3-methoxybenzonitrile and m-Anisonitrile, 4-hydroxy.
What is the molecular weight of vanillonitrile?
The molecular weight of vanillonitrile is 149.15 g/mol.
What is the IUPAC name of vanillonitrile?
The IUPAC name of vanillonitrile is 4-hydroxy-3-methoxybenzonitrile.
What is the InChI of vanillonitrile?
The InChI of vanillonitrile is InChI=1S/C8H7NO2/c1-11-8-4-6(5-9)2-3-7(8)10/h2-4,10H,1H3.
What is the InChIKey of vanillonitrile?
The InChIKey of vanillonitrile is QJRWLNLUIAJTAD-UHFFFAOYSA-N.
What is the canonical SMILES of vanillonitrile?
The canonical SMILES of vanillonitrile is COC1=C(C=CC(=C1)C#N)O.
What is the CAS number of vanillonitrile?
The CAS number of vanillonitrile is 4421-08-3.
Is vanillonitrile a covalently-bonded unit?
Yes, vanillonitrile is a covalently-bonded unit.