What is the molecular formula of thianthrene?
The molecular formula of thianthrene is C12H8S2.
What is the molecular weight of thianthrene?
The molecular weight of thianthrene is 216.3 g/mol.
What are the synonyms for thianthrene?
The synonyms for thianthrene are THIANTHRENE, 92-85-3, Thianthren, and Thiaanthrene.
When was thianthrene created?
Thianthrene was created on March 26, 2005.
What is the IUPAC name of thianthrene?
The IUPAC name of thianthrene is thianthrene.
What is the InChI of thianthrene?
The InChI of thianthrene is InChI=1S/C12H8S2/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10/h1-8H.
What is the InChIKey of thianthrene?
The InChIKey of thianthrene is GVIJJXMXTUZIOD-UHFFFAOYSA-N.
What is the canonical SMILES of thianthrene?
The canonical SMILES of thianthrene is C1=CC=C2C(=C1)SC3=CC=CC=C3S2.
What is the CAS number of thianthrene?
The CAS number of thianthrene is 92-85-3.