What is the PubChem CID for 4-Phenylphenol?
The PubChem CID for 4-Phenylphenol is 7103.
What is the molecular formula of 4-Phenylphenol?
The molecular formula of 4-Phenylphenol is C12H10O.
What is the molecular weight of 4-Phenylphenol?
The molecular weight of 4-Phenylphenol is 170.21 g/mol.
What are some synonyms for 4-Phenylphenol?
Some synonyms for 4-Phenylphenol include 4-HYDROXYBIPHENYL, Biphenyl-4-ol, and [1,1'-Biphenyl]-4-ol.
What is the IUPAC name of 4-Phenylphenol?
The IUPAC name of 4-Phenylphenol is 4-phenylphenol.
What is the InChIKey of 4-Phenylphenol?
The InChIKey of 4-Phenylphenol is YXVFYQXJAXKLAK-UHFFFAOYSA-N.
What is the CAS number of 4-Phenylphenol?
The CAS number of 4-Phenylphenol is 92-69-3.
What is the ChEMBL ID of 4-Phenylphenol?
The ChEMBL ID of 4-Phenylphenol is CHEMBL73380.
What is the formal charge of 4-Phenylphenol?
The formal charge of 4-Phenylphenol is not specified in the reference.
What is the canonical SMILES of 4-Phenylphenol?
The canonical SMILES of 4-Phenylphenol is C1=CC=C(C=C1)C2=CC=C(C=C2)O.
What is the UNII of 4-Phenylphenol?
The UNII of 4-Phenylphenol is 50LH4BZ6MD.
What is the XLogP3 value of 4-Phenylphenol?
The XLogP3 value of 4-Phenylphenol is 3.2.
What is the hydrogen bond donor count of 4-Phenylphenol?
The hydrogen bond donor count of 4-Phenylphenol is 1.