What is the PubChem CID of Proflavine?
PubChem CID 7099
What is the molecular formula of Proflavine?
The molecular formula of Proflavine is C13H11N3.
What are the synonyms for Proflavine?
The synonyms for Proflavine include Proflavine acridine-3,6-diamine, Proflavin, and 92-62-6.
What is the molecular weight of Proflavine?
The molecular weight of Proflavine is 209.25 g/mol.
When was Proflavine created and modified?
Proflavine was created on March 26, 2005, and last modified on December 30, 2023.
What is the description of Proflavine?
Proflavine is a slow-acting bacteriostat that is effective against many Gram-positive bacteria. It is an antiseptic drug, a carcinogenic agent, an antibacterial agent, a chromophore, and an intercalator. It was used for the treatment of burns and infected wounds.
What is the IUPAC name of Proflavine?
The IUPAC name of Proflavine is acridine-3,6-diamine.
What is the InChIKey of Proflavine?
The InChIKey of Proflavine is WDVSHHCDHLJJJR-UHFFFAOYSA-N.
What is the canonical SMILES of Proflavine?
The canonical SMILES of Proflavine is C1=CC(=CC2=NC3=C(C=CC(=C3)N)C=C21)N.
What are some other identifiers for Proflavine?
Some other identifiers for Proflavine include its CAS number (92-62-6), EC Numbers (202-172-4, 217-320-3), UNII (CY3RNB3K4T), ChEMBL ID (CHEMBL55400), and Wikidata ID (Q420454).