What is the molecular formula of 4-[(Ethylanilino)methyl]benzenesulphonic acid?
The molecular formula of 4-[(Ethylanilino)methyl]benzenesulphonic acid is C15H17NO3S.
What is the molecular weight of 4-[(Ethylanilino)methyl]benzenesulphonic acid?
The molecular weight of 4-[(Ethylanilino)methyl]benzenesulphonic acid is 291.4 g/mol.
What is the IUPAC name of 4-[(Ethylanilino)methyl]benzenesulphonic acid?
The IUPAC name of 4-[(Ethylanilino)methyl]benzenesulphonic acid is 4-[(N-ethylanilino)methyl]benzenesulfonic acid.
What is the InChI of 4-[(Ethylanilino)methyl]benzenesulphonic acid?
The InChI of 4-[(Ethylanilino)methyl]benzenesulphonic acid is InChI=1S/C15H17NO3S/c1-2-16(14-6-4-3-5-7-14)12-13-8-10-15(11-9-13)20(17,18)19/h3-11H,2,12H2,1H3,(H,17,18,19).
What is the InChIKey of 4-[(Ethylanilino)methyl]benzenesulphonic acid?
The InChIKey of 4-[(Ethylanilino)methyl]benzenesulphonic acid is HSBRAZWXTOKJQF-UHFFFAOYSA-N.
What is the canonical SMILES of 4-[(Ethylanilino)methyl]benzenesulphonic acid?
The canonical SMILES of 4-[(Ethylanilino)methyl]benzenesulphonic acid is CCN(CC1=CC=C(C=C1)S(=O)(=O)O)C2=CC=CC=C2.
What is the CAS number of 4-[(Ethylanilino)methyl]benzenesulphonic acid?
The CAS number of 4-[(Ethylanilino)methyl]benzenesulphonic acid is 92-60-4.
What is the European Community (EC) number of 4-[(Ethylanilino)methyl]benzenesulphonic acid?
The European Community (EC) number of 4-[(Ethylanilino)methyl]benzenesulphonic acid is 202-170-3.
What is the UNII of 4-[(Ethylanilino)methyl]benzenesulphonic acid?
The UNII of 4-[(Ethylanilino)methyl]benzenesulphonic acid is Z3DU75V1GX.
※ Please kindly note that our products are for research use only.