What is the molecular formula of N-Benzyl-N-ethylsulfanil acid?
The molecular formula of N-Benzyl-N-ethylsulfanil acid is C15H17NO3S.
What is the PubChem CID of N-Benzyl-N-ethylsulfanil acid?
The PubChem CID of N-Benzyl-N-ethylsulfanil acid is 66709.
What are the synonyms of N-Benzyl-N-ethylsulfanil acid?
The synonyms of N-Benzyl-N-ethylsulfanil acid are 92-56-8, Benzenesulfonic acid, 4-[ethyl(phenylmethyl)amino]-, O526BFP7CZ, Benzenesulfonic acid, 4-(ethyl(phenylmethyl)amino)-.
What is the molecular weight of N-Benzyl-N-ethylsulfanil acid?
The molecular weight of N-Benzyl-N-ethylsulfanil acid is 291.4 g/mol.
What is the IUPAC name of N-Benzyl-N-ethylsulfanil acid?
The IUPAC name of N-Benzyl-N-ethylsulfanil acid is 4-[benzyl(ethyl)amino]benzenesulfonic acid.
What is the InChI of N-Benzyl-N-ethylsulfanil acid?
The InChI of N-Benzyl-N-ethylsulfanil acid is InChI=1S/C15H17NO3S/c1-2-16(12-13-6-4-3-5-7-13)14-8-10-15(11-9-14)20(17,18)19/h3-11H,2,12H2,1H3,(H,17,18,19).
What is the InChIKey of N-Benzyl-N-ethylsulfanil acid?
The InChIKey of N-Benzyl-N-ethylsulfanil acid is OZBLZWHUFCFATD-UHFFFAOYSA-N.
What is the canonical SMILES of N-Benzyl-N-ethylsulfanil acid?
The canonical SMILES of N-Benzyl-N-ethylsulfanil acid is CCN(CC1=CC=CC=C1)C2=CC=C(C=C2)S(=O)(=O)O.
What is the CAS number of N-Benzyl-N-ethylsulfanil acid?
The CAS number of N-Benzyl-N-ethylsulfanil acid is 92-56-8.
What is the European Community (EC) number of N-Benzyl-N-ethylsulfanil acid?
The European Community (EC) number of N-Benzyl-N-ethylsulfanil acid is 202-167-7.
※ Please kindly note that our products are for research use only.
Download
![Thieno[3,4-b]-1,4-dioxin,2,3-dihydro-5-(4-methoxyphenyl)-](https://resource.alfa-chemistry.com/structure/925674-54-0.gif)
![Pyridine,2-(2,3-dihydrothieno[3,4-b]-1,4-dioxin-5-yl)-](https://resource.alfa-chemistry.com/structure/925674-61-9.gif)
