What is the molecular formula of 4-phenylmorpholine?
The molecular formula of 4-phenylmorpholine is C10H13NO.
What is the molecular weight of 4-phenylmorpholine?
The molecular weight of 4-phenylmorpholine is 163.22 g/mol.
What is the IUPAC name of 4-phenylmorpholine?
The IUPAC name of 4-phenylmorpholine is 4-phenylmorpholine.
What is the InChI of 4-phenylmorpholine?
The InChI of 4-phenylmorpholine is InChI=1S/C10H13NO/c1-2-4-10(5-3-1)11-6-8-12-9-7-11/h1-5H,6-9H2.
What is the InChIKey of 4-phenylmorpholine?
The InChIKey of 4-phenylmorpholine is FHQRDEDZJIFJAL-UHFFFAOYSA-N.
What is the canonical SMILES of 4-phenylmorpholine?
The canonical SMILES of 4-phenylmorpholine is C1COCCN1C2=CC=CC=C2.
What is the CAS number of 4-phenylmorpholine?
The CAS number of 4-phenylmorpholine is 92-53-5.
How many hydrogen bond donor counts does 4-phenylmorpholine have?
4-phenylmorpholine has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 4-phenylmorpholine have?
4-phenylmorpholine has 2 hydrogen bond acceptor counts.