What is the molecular formula of 2-Propionylphenothiazine?
The molecular formula of 2-Propionylphenothiazine is C15H13NOS.
What is the molecular weight of 2-Propionylphenothiazine?
The molecular weight of 2-Propionylphenothiazine is 255.3 g/mol.
What is the IUPAC name of 2-Propionylphenothiazine?
The IUPAC name of 2-Propionylphenothiazine is 1-(10H-phenothiazin-2-yl)propan-1-one.
What is the InChI of 2-Propionylphenothiazine?
The InChI of 2-Propionylphenothiazine is InChI=1S/C15H13NOS/c1-2-13(17)10-7-8-15-12(9-10)16-11-5-3-4-6-14(11)18-15/h3-9,16H,2H2,1H3.
What is the InChIKey of 2-Propionylphenothiazine?
The InChIKey of 2-Propionylphenothiazine is XPGPHJNCOZQFAU-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Propionylphenothiazine?
The canonical SMILES of 2-Propionylphenothiazine is CCC(=O)C1=CC2=C(C=C1)SC3=CC=CC=C3N2.
What is the CAS number of 2-Propionylphenothiazine?
The CAS number of 2-Propionylphenothiazine is 92-33-1.
What is the European Community (EC) number of 2-Propionylphenothiazine?
The European Community (EC) number of 2-Propionylphenothiazine is 202-148-3.
What is the UNII of 2-Propionylphenothiazine?
The UNII of 2-Propionylphenothiazine is 9Y1069S49S.
Is 2-Propionylphenothiazine a canonicalized compound?
Yes, 2-Propionylphenothiazine is a canonicalized compound according to PubChem.