What is the molecular formula of phenyltoloxamine?
The molecular formula of phenyltoloxamine is C17H21NO.
What is the molecular weight of phenyltoloxamine?
The molecular weight of phenyltoloxamine is 255.35 g/mol.
What is the IUPAC name of phenyltoloxamine?
The IUPAC name of phenyltoloxamine is 2-(2-benzylphenoxy)-N,N-dimethylethanamine.
What is the InChI of phenyltoloxamine?
The InChI of phenyltoloxamine is InChI=1S/C17H21NO/c1-18(2)12-13-19-17-11-7-6-10-16(17)14-15-8-4-3-5-9-15/h3-11H,12-14H2,1-2H3.
What is the InChIKey of phenyltoloxamine?
The InChIKey of phenyltoloxamine is IZRPKIZLIFYYKR-UHFFFAOYSA-N.
What is the canonical SMILES of phenyltoloxamine?
The canonical SMILES of phenyltoloxamine is CN(C)CCOC1=CC=CC=C1CC2=CC=CC=C2.
What is the CAS number of phenyltoloxamine?
The CAS number of phenyltoloxamine is 92-12-6.
What is the common chemistry CAS number of phenyltoloxamine?
The common chemistry CAS number of phenyltoloxamine is 92-12-6.
What is the ChemIDplus CAS number of phenyltoloxamine hydrochloride?
The ChemIDplus CAS number of phenyltoloxamine hydrochloride is 6152-43-8.
What is the EC number of phenyltoloxamine?
The EC number of phenyltoloxamine is 202-127-9.