What is the molecular formula of Benzenebutanoicacid,b-amino-3-bromo-?
The molecular formula of Benzenebutanoicacid,b-amino-3-bromo- is C10H13BrClNO2.
How is the molecular weight of Benzenebutanoicacid,b-amino-3-bromo- determined?
The molecular weight of Benzenebutanoicacid,b-amino-3-bromo- is computed by PubChem, and it is 294.57 g/mol.
What is the parent compound of Benzenebutanoicacid,b-amino-3-bromo-?
The parent compound of Benzenebutanoicacid,b-amino-3-bromo- is CID 90478030, which is (3S)-3-amino-4-(3-bromophenyl)butanoic acid.
What are the synonyms for Benzenebutanoicacid,b-amino-3-bromo-?
The synonyms for Benzenebutanoicacid,b-amino-3-bromo- are (3S)-3-amino-4-(3-bromophenyl)butanoic acid hydrochloride, (S)-3-Amino-4-(3-bromophenyl)butanoic acid hydrochloride, and Benzenebutanoicacid, b-amino-3-bromo-.
What is the IUPAC name of Benzenebutanoicacid,b-amino-3-bromo-?
The IUPAC name of Benzenebutanoicacid,b-amino-3-bromo- is (3S)-3-amino-4-(3-bromophenyl)butanoic acid hydrochloride.
What is the InChI key of Benzenebutanoicacid,b-amino-3-bromo-?
The InChI key of Benzenebutanoicacid,b-amino-3-bromo- is OWNVEWYNSXDFOL-FVGYRXGTSA-N.
What is the canonical SMILES of Benzenebutanoicacid,b-amino-3-bromo-?
The canonical SMILES of Benzenebutanoicacid,b-amino-3-bromo- is C1=CC(=CC(=C1)Br)CC(CC(=O)O)N.Cl.
What is the hydrogen bond donor count of Benzenebutanoicacid,b-amino-3-bromo-?
The hydrogen bond donor count of Benzenebutanoicacid,b-amino-3-bromo- is 3.
What is the hydrogen bond acceptor count of Benzenebutanoicacid,b-amino-3-bromo-?
The hydrogen bond acceptor count of Benzenebutanoicacid,b-amino-3-bromo- is 3.
Is Benzenebutanoicacid,b-amino-3-bromo- considered a canonicalized compound?
Yes, Benzenebutanoicacid,b-amino-3-bromo- is considered a canonicalized compound.
※ Please kindly note that our products are for research use only.