What is the PubChem CID of 6-Bromo-7-methylimidazo[4,5-b]pyridine?
PubChem CID 53485286.
What is the molecular formula of 6-Bromo-7-methylimidazo[4,5-b]pyridine?
The molecular formula is C7H6BrN3.
What are the synonyms of 6-Bromo-7-methylimidazo[4,5-b]pyridine?
The synonyms are 6-bromo-7-methyl-1H-imidazo[4,5-b]pyridine, 91996-63-3, 6-Bromo-7-methyl-3H-imidazo[4,5-b]pyridine, 6-Bromo-7-methylimidazo[4,5-b]pyridine.
When was 6-Bromo-7-methylimidazo[4,5-b]pyridine created in PubChem?
It was created on November 16, 2011.
What is the molecular weight of 6-Bromo-7-methylimidazo[4,5-b]pyridine?
The molecular weight is 212.05 g/mol.
What is the IUPAC name of 6-Bromo-7-methylimidazo[4,5-b]pyridine?
The IUPAC name is 6-bromo-7-methyl-1H-imidazo[4,5-b]pyridine.
What is the InChI of 6-Bromo-7-methylimidazo[4,5-b]pyridine?
The InChI is InChI=1S/C7H6BrN3/c1-4-5(8)2-9-7-6(4)10-3-11-7/h2-3H,1H3,(H,9,10,11).
What is the InChIKey of 6-Bromo-7-methylimidazo[4,5-b]pyridine?
The InChIKey is XVEGORLAVIFJMX-UHFFFAOYSA-N.
What is the Canonical SMILES of 6-Bromo-7-methylimidazo[4,5-b]pyridine?
The Canonical SMILES is CC1=C2C(=NC=C1Br)N=CN2.
What is the CAS number of 6-Bromo-7-methylimidazo[4,5-b]pyridine?
The CAS number is 91996-63-3.
※ Please kindly note that our products are for research use only.