What is the PubChem CID of cis-Tranilast?
The PubChem CID of cis-Tranilast is 6604021.
What is the molecular formula of cis-Tranilast?
The molecular formula of cis-Tranilast is C18H17NO5.
What are the synonyms of cis-Tranilast?
The synonyms of cis-Tranilast are 91920-58-0, 2-[[(Z)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]benzoic acid, Tocris-1098, Lopac-T-0318, and more.
What is the computed molecular weight of cis-Tranilast?
The computed molecular weight of cis-Tranilast is 327.3 g/mol.
What is the IUPAC name of cis-Tranilast?
The IUPAC name of cis-Tranilast is 2-[[(Z)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]benzoic acid.
What is the InChI of cis-Tranilast?
The InChI of cis-Tranilast is InChI=1S/C18H17NO5/c1-23-15-9-7-12(11-16(15)24-2)8-10-17(20)19-14-6-4-3-5-13(14)18(21)22/h3-11H,1-2H3,(H,19,20)(H,21,22)/b10-8-.
What is the InChIKey of cis-Tranilast?
The InChIKey of cis-Tranilast is NZHGWWWHIYHZNX-NTMALXAHSA-N.
What is the canonical SMILES of cis-Tranilast?
The canonical SMILES of cis-Tranilast is COC1=C(C=C(C=C1)C=CC(=O)NC2=CC=CC=C2C(=O)O)OC.
What are the other identifiers for cis-Tranilast?
The other identifiers for cis-Tranilast are CAS: 91920-58-0, ChEMBL ID: CHEMBL1474479, DSSTox Substance ID: DTXSID30424972, Nikkaji Number: J511.890E, and Wikidata: Q82237724.
What is the XLogP3-AA value of cis-Tranilast?
The XLogP3-AA value of cis-Tranilast is 3.2.