The fluorescent compound synthesized by 4-Chloro-3-ethylphenylboronic acid has a special response to sugar molecules and can be used for the detection of sugar molecules.
What is the molecular formula of 4-Chloro-3-ethylphenylboronic acid?
The molecular formula of 4-Chloro-3-ethylphenylboronic acid is C8H10BClO2.
What is the molecular weight of 4-Chloro-3-ethylphenylboronic acid?
The molecular weight of 4-Chloro-3-ethylphenylboronic acid is 184.43 g/mol.
What is the IUPAC name of 4-Chloro-3-ethylphenylboronic acid?
The IUPAC name of 4-Chloro-3-ethylphenylboronic acid is (4-chloro-3-ethylphenyl)boronic acid.
What is the InChI of 4-Chloro-3-ethylphenylboronic acid?
The InChI of 4-Chloro-3-ethylphenylboronic acid is InChI=1S/C8H10BClO2/c1-2-6-5-7(9(11)12)3-4-8(6)10/h3-5,11-12H,2H2,1H3.
What is the InChIKey of 4-Chloro-3-ethylphenylboronic acid?
The InChIKey of 4-Chloro-3-ethylphenylboronic acid is ZFQZOBHIZWUBEZ-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Chloro-3-ethylphenylboronic acid?
The canonical SMILES of 4-Chloro-3-ethylphenylboronic acid is B(C1=CC(=C(C=C1)Cl)CC)(O)O.
What is the CAS number of 4-Chloro-3-ethylphenylboronic acid?
The CAS number of 4-Chloro-3-ethylphenylboronic acid is 918810-94-3.
What is the hydrogen bond donor count of 4-Chloro-3-ethylphenylboronic acid?
The hydrogen bond donor count of 4-Chloro-3-ethylphenylboronic acid is 2.
What is the hydrogen bond acceptor count of 4-Chloro-3-ethylphenylboronic acid?
The hydrogen bond acceptor count of 4-Chloro-3-ethylphenylboronic acid is 2.
Is 4-Chloro-3-ethylphenylboronic acid a canonicalized compound?
Yes, 4-Chloro-3-ethylphenylboronic acid is a canonicalized compound.
※ Please kindly note that our products are for research use only.
Download
![5-Chloro-1-Triisopropylsilanyl-1H-Pyrrolo[2,3-B]Pyridine](https://resource.alfa-chemistry.com/structure/918523-59-8.gif)
