What is the molecular formula of 3-(Benzyloxy)-2-chloro-6-fluorobenzaldehyde?
The molecular formula is C14H10ClFO2.
What are the synonyms for 3-(Benzyloxy)-2-chloro-6-fluorobenzaldehyde?
The synonyms are 918524-12-6, 3-Benzyloxy-2-chloro-6-fluoro-benzaldehyde, 2-chloro-6-fluoro-3-phenylmethoxybenzaldehyde, Benzaldehyde, 2-chloro-6-fluoro-3-(phenylmethoxy).
What is the molecular weight of 3-(Benzyloxy)-2-chloro-6-fluorobenzaldehyde?
The molecular weight is 264.68 g/mol.
When was 3-(Benzyloxy)-2-chloro-6-fluorobenzaldehyde created?
It was created on August 19, 2012.
What is the IUPAC name of 3-(Benzyloxy)-2-chloro-6-fluorobenzaldehyde?
The IUPAC name is 2-chloro-6-fluoro-3-phenylmethoxybenzaldehyde.
What is the InChI of 3-(Benzyloxy)-2-chloro-6-fluorobenzaldehyde?
The InChI is InChI=1S/C14H10ClFO2/c15-14-11(8-17)12(16)6-7-13(14)18-9-10-4-2-1-3-5-10/h1-8H,9H2.
What is the InChIKey of 3-(Benzyloxy)-2-chloro-6-fluorobenzaldehyde?
The InChI key is BPNKGKIYWCCWSY-UHFFFAOYSA-N.
What is the canonical SMILES of 3-(Benzyloxy)-2-chloro-6-fluorobenzaldehyde?
The canonical SMILES is C1=CC=C(C=C1)COC2=C(C(=C(C=C2)F)C=O)Cl.
What is the CAS number of 3-(Benzyloxy)-2-chloro-6-fluorobenzaldehyde?
The CAS number is 918524-12-6.
※ Please kindly note that our products are for research use only.