The molecular formula of the compound is C10H12BrN3O3.
What are the synonyms for the compound?
The synonyms for the compound are: 917918-81-1 5-Bromo-4-[2-(dimethylamino)ethenyl]-2-methoxy-3-nitropyridine 2-(5-Bromo-2-methoxy-3-nitropyridin-4-yl)-N,N-dimethylethenamine Ethenamine, 2-(5-bromo-2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethyl- (E)-2-(5-bromo-2-methoxy-3-nitropyridin-4-yl)-N,N-dimethylethenamine
What is the molecular weight of the compound?
The molecular weight of the compound is 302.12 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is (E)-2-(5-bromo-2-methoxy-3-nitropyridin-4-yl)-N,N-dimethylethenamine.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C10H12BrN3O3/c1-13(2)5-4-7-8(11)6-12-10(17-3)9(7)14(15)16/h4-6H,1-3H3/b5-4+.
What is the InChIKey of the compound?
The InChIKey of the compound is BNKMXMCVPWPRMR-SNAWJCMRSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CN(C)C=CC1=C(C(=NC=C1Br)OC)[N+](=O)[O-].
What is the isomeric SMILES of the compound?
The isomeric SMILES of the compound is CN(C)/C=C/C1=C(C(=NC=C1Br)OC)[N+](=O)[O-].
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 2.2.
How many hydrogen bond acceptors does the compound have?
The compound has 5 hydrogen bond acceptors.
※ Please kindly note that our products are for research use only.