What is the molecular formula of Sodium-11-acrylamido-undecanoate?
The molecular formula of Sodium-11-acrylamido-undecanoate is C14H24NNaO3.
What is the molecular weight of Sodium-11-acrylamido-undecanoate?
The molecular weight of Sodium-11-acrylamido-undecanoate is 277.33 g/mol.
What is the IUPAC name of Sodium-11-acrylamido-undecanoate?
The IUPAC name of Sodium-11-acrylamido-undecanoate is sodium;11-(prop-2-enoylamino)undecanoate.
What is the InChI of Sodium-11-acrylamido-undecanoate?
The InChI of Sodium-11-acrylamido-undecanoate is InChI=1S/C14H25NO3.Na/c1-2-13(16)15-12-10-8-6-4-3-5-7-9-11-14(17)18;/h2H,1,3-12H2,(H,15,16)(H,17,18);/q;+1/p-1.
What is the InChIKey of Sodium-11-acrylamido-undecanoate?
The InChIKey of Sodium-11-acrylamido-undecanoate is VRXMFOZNEBYZOE-UHFFFAOYSA-M.
What is the canonical SMILES of Sodium-11-acrylamido-undecanoate?
The canonical SMILES of Sodium-11-acrylamido-undecanoate is C=CC(=O)NCCCCCCCCCCC(=O)[O-].[Na+].
What is the CAS number of Sodium-11-acrylamido-undecanoate?
The CAS number of Sodium-11-acrylamido-undecanoate is 91777-68-3.
What is the hydrogen bond donor count of Sodium-11-acrylamido-undecanoate?
Sodium-11-acrylamido-undecanoate has 1 hydrogen bond donor.
What is the hydrogen bond acceptor count of Sodium-11-acrylamido-undecanoate?
Sodium-11-acrylamido-undecanoate has 3 hydrogen bond acceptors.
What is the rotatable bond count of Sodium-11-acrylamido-undecanoate?
Sodium-11-acrylamido-undecanoate has 12 rotatable bonds.
※ Please kindly note that our products are for research use only.