What is the molecular formula of D-fructopyranose?
The molecular formula of D-fructopyranose is C6H12O6.
What is the molecular weight of D-fructopyranose?
The molecular weight of D-fructopyranose is 180.16 g/mol.
What is the IUPAC name of D-fructopyranose?
The IUPAC name of D-fructopyranose is (3S,4R,5R)-2-(hydroxymethyl)oxane-2,3,4,5-tetrol.
What is the Canonical SMILES of D-fructopyranose?
The Canonical SMILES of D-fructopyranose is C1C(C(C(C(O1)(CO)O)O)O)O.
Is D-fructopyranose a sweetening agent?
D-fructopyranose has a role as a sweetening agent.
Where is D-fructose found?
D-fructose is found in or produced by Escherichia coli (strain K12, MG1655) according to ECBMDB.
What is the CAS number of D-fructopyranose?
The CAS number of D-fructopyranose is 6347-01-9.
How many hydrogen bond donor counts does D-fructopyranose have?
D-fructopyranose has 5 hydrogen bond donor counts.
What is the XLogP3-AA value of D-fructopyranose?
The XLogP3-AA value of D-fructopyranose is -2.8.
What is the Heavy Atom Count of D-fructopyranose?
The Heavy Atom Count of D-fructopyranose is 12.