What is the molecular formula of 1-Methyl-1H-imidazole-4-acetic acid ethyl ester?
The molecular formula of 1-Methyl-1H-imidazole-4-acetic acid ethyl ester is C8H12N2O2.
What are the synonyms for 1-Methyl-1H-imidazole-4-acetic acid ethyl ester?
The synonyms for 1-Methyl-1H-imidazole-4-acetic acid ethyl ester include Ethyl 2-(1-methyl-1H-imidazol-4-yl)acetate, 916792-95-5, ethyl 2-(1-methylimidazol-4-yl)acetate, and 1-methyl-1H-Imidazole-4-acetic acid ethyl ester.
What is the molecular weight of 1-Methyl-1H-imidazole-4-acetic acid ethyl ester?
The molecular weight of 1-Methyl-1H-imidazole-4-acetic acid ethyl ester is 168.19 g/mol.
What is the IUPAC name of 1-Methyl-1H-imidazole-4-acetic acid ethyl ester?
The IUPAC name of 1-Methyl-1H-imidazole-4-acetic acid ethyl ester is ethyl 2-(1-methylimidazol-4-yl)acetate.
What is the InChI of 1-Methyl-1H-imidazole-4-acetic acid ethyl ester?
The InChI of 1-Methyl-1H-imidazole-4-acetic acid ethyl ester is InChI=1S/C8H12N2O2/c1-3-12-8(11)4-7-5-10(2)6-9-7/h5-6H,3-4H2,1-2H3.
What is the InChIKey of 1-Methyl-1H-imidazole-4-acetic acid ethyl ester?
The InChIKey of 1-Methyl-1H-imidazole-4-acetic acid ethyl ester is ZWILSHXSICOQDH-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Methyl-1H-imidazole-4-acetic acid ethyl ester?
The canonical SMILES of 1-Methyl-1H-imidazole-4-acetic acid ethyl ester is CCOC(=O)CC1=CN(C=N1)C.
What is the XLogP3-AA value for 1-Methyl-1H-imidazole-4-acetic acid ethyl ester?
The XLogP3-AA value for 1-Methyl-1H-imidazole-4-acetic acid ethyl ester is 0.2.
How many hydrogen bond donor counts does 1-Methyl-1H-imidazole-4-acetic acid ethyl ester have?
1-Methyl-1H-imidazole-4-acetic acid ethyl ester has 0 hydrogen bond donor counts.
How many rotatable bond counts does 1-Methyl-1H-imidazole-4-acetic acid ethyl ester have?
1-Methyl-1H-imidazole-4-acetic acid ethyl ester has 4 rotatable bond counts.
※ Please kindly note that our products are for research use only.