What is the molecular formula of 2,6-Dibromopiperidine?
The molecular formula of 2,6-Dibromopiperidine is C5H9Br2N.
What is the molecular weight of 2,6-Dibromopiperidine?
The molecular weight of 2,6-Dibromopiperidine is 242.94 g/mol.
What is the IUPAC name of 2,6-Dibromopiperidine?
The IUPAC name of 2,6-Dibromopiperidine is 2,6-dibromopiperidine.
What is the InChI of 2,6-Dibromopiperidine?
The InChI of 2,6-Dibromopiperidine is InChI=1S/C5H9Br2N/c6-4-2-1-3-5(7)8-4/h4-5,8H,1-3H2.
What is the InChIKey of 2,6-Dibromopiperidine?
The InChIKey of 2,6-Dibromopiperidine is KUJVSBNVZUZOMF-UHFFFAOYSA-N.
What is the canonical SMILES of 2,6-Dibromopiperidine?
The canonical SMILES of 2,6-Dibromopiperidine is C1CC(NC(C1)Br)Br.
What is the CAS number of 2,6-Dibromopiperidine?
The CAS number of 2,6-Dibromopiperidine is 916792-59-1.
What is the XLogP3-AA value of 2,6-Dibromopiperidine?
The XLogP3-AA value of 2,6-Dibromopiperidine is 2.5.
How many hydrogen bond donor counts does 2,6-Dibromopiperidine have?
2,6-Dibromopiperidine has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2,6-Dibromopiperidine have?
2,6-Dibromopiperidine has 1 hydrogen bond acceptor count.