What is the molecular formula of Ys121?
The molecular formula of Ys121 is C20H26ClN3O2S.
What is the molecular weight of Ys121?
The molecular weight of Ys121 is 408.0 g/mol.
When was Ys121 created?
Ys121 was created on June 23, 2008.
What is the IUPAC Name of Ys121?
The IUPAC Name of Ys121 is 2-[4-chloro-6-(2,3-dimethylanilino)pyrimidin-2-yl]sulfanyloctanoic acid.
What is the Canonical SMILES of Ys121?
The Canonical SMILES of Ys121 is CCCCCCC(C(=O)O)SC1=NC(=CC(=N1)Cl)NC2=CC=CC(=C2C)C.
What is the InChIKey of Ys121?
The InChIKey of Ys121 HVJBWTVMRIOTEL-UHFFFAOYSA-N.
What is the XLogP3-AA value of Ys121?
The XLogP3-AA value of Ys121 is 7.1.
How many hydrogen bond donor counts does Ys121 have?
Ys121 has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Ys121 have?
Ys121 has 6 hydrogen bond acceptor counts.
Is the compound Ys121 canonicalized?
Yes, the compound Ys121 is canonicalized.
Download
![Ethanone,1-[4-(2-aminophenyl)-1-piperazinyl]-](https://resource.alfa-chemistry.com/structure/91646-45-6.gif)
![Zinc,[1,2-ethanediylbis[nitrilobis(methylene)]]tetrakis[phosphonic acid] complexes](https://resource.alfa-chemistry.com/structure/91648-76-9.gif)
![Piperazine,1-[2-(methylsulfonyl)phenyl]-,hydrochloride(1:2)](https://resource.alfa-chemistry.com/structure/916488-42-1.gif)
