What is the molecular formula of Chembrdg-bb 7848397?
The molecular formula of Chembrdg-bb 7848397 is C12H15N3O.
What are the synonyms of Chembrdg-bb 7848397?
The synonyms of Chembrdg-bb 7848397 are 91643-11-7, N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]propan-2-amine, and N-((3-Phenyl-1,2,4-oxadiazol-5-yl)methyl)propan-2-amine.
What is the molecular weight of Chembrdg-bb 7848397?
The molecular weight of Chembrdg-bb 7848397 is 217.27 g/mol.
When was Chembrdg-bb 7848397 created?
Chembrdg-bb 7848397 was created on July 9, 2005.
What is the IUPAC name of Chembrdg-bb 7848397?
The IUPAC name of Chembrdg-bb 7848397 is N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]propan-2-amine.
What is the InChI of Chembrdg-bb 7848397?
The InChI of Chembrdg-bb 7848397 is InChI=1S/C12H15N3O/c1-9(2)13-8-11-14-12(15-16-11)10-6-4-3-5-7-10/h3-7,9,13H,8H2,1-2H3.
What is the InChIKey of Chembrdg-bb 7848397?
The InChIKey of Chembrdg-bb 7848397 is VJZJKBVSVGMIGW-UHFFFAOYSA-N.
What is the canonical SMILES of Chembrdg-bb 7848397?
The canonical SMILES of Chembrdg-bb 7848397 is CC(C)NCC1=NC(=NO1)C2=CC=CC=C2.
What is the CAS number of Chembrdg-bb 7848397?
The CAS number of Chembrdg-bb 7848397 is 91643-11-7.
What is the formal charge of Chembrdg-bb 7848397?
The formal charge of Chembrdg-bb 7848397 is 0.