What is the molecular formula of Chembrdg-bb 4010196?
The molecular formula of Chembrdg-bb 4010196 is C12H15N3.
What is the molecular weight of Chembrdg-bb 4010196?
The molecular weight of Chembrdg-bb 4010196 is 201.27 g/mol.
When was Chembrdg-bb 4010196 created?
Chembrdg-bb 4010196 was created on July 9, 2005.
What is the IUPAC name of Chembrdg-bb 4010196?
The IUPAC name of Chembrdg-bb 4010196 is 5-ethyl-4-methyl-2-phenylpyrazol-3-amine.
What is the InChI of Chembrdg-bb 4010196?
The InChI of Chembrdg-bb 4010196 is InChI=1S/C12H15N3/c1-3-11-9(2)12(13)15(14-11)10-7-5-4-6-8-10/h4-8H,3,13H2,1-2H3.
What is the InChIKey of Chembrdg-bb 4010196?
The InChIKey of Chembrdg-bb 4010196 is HCFCJMAWRYDNBB-UHFFFAOYSA-N.
What is the canonical SMILES of Chembrdg-bb 4010196?
The canonical SMILES of Chembrdg-bb 4010196 is CCC1=NN(C(=C1C)N)C2=CC=CC=C2.
What is the CAS number of Chembrdg-bb 4010196?
The CAS number of Chembrdg-bb 4010196 is 91642-97-6.
What is the XLogP3-AA value of Chembrdg-bb 4010196?
The XLogP3-AA value of Chembrdg-bb 4010196 is 2.7.
Is Chembrdg-bb 4010196 a canonicalized compound?
Yes, Chembrdg-bb 4010196 is a canonicalized compound.