What is the PubChem CID for Ibafloxacine?
The PubChem CID for Ibafloxacine is 71186.
What is the molecular formula of Ibafloxacine?
The molecular formula of Ibafloxacine is C15H14FNO3.
What is the molecular weight of Ibafloxacine?
The molecular weight of Ibafloxacine is 275.27 g/mol.
When was Ibafloxacine created?
Ibafloxacine was created on August 1, 2005.
When was Ibafloxacine last modified?
Ibafloxacine was last modified on December 30, 2023.
What is the IUPAC name of Ibafloxacine?
The IUPAC name of Ibafloxacine is 7-fluoro-8,12-dimethyl-4-oxo-1-azatricyclo[7.3.1.0 5,13 ]trideca-2,5,7,9(13)-tetraene-3-carboxylic acid.
What is the InChI of Ibafloxacine?
The InChI of Ibafloxacine is InChI=1S/C15H14FNO3/c1-7-3-4-9-8(2)12(16)5-10-13(9)17(7)6-11(14(10)18)15(19)20/h5-7H,3-4H2,1-2H3,(H,19,20).
What is the InChIKey of Ibafloxacine?
The InChIKey of Ibafloxacine is DXKRGNXUIRKXNR-UHFFFAOYSA-N.
What is the Canonical SMILES of Ibafloxacine?
The Canonical SMILES of Ibafloxacine is CC1CCC2=C3N1C=C(C(=O)C3=CC(=C2C)F)C(=O)O.
What is the CAS number of Ibafloxacine?
The CAS number of Ibafloxacine is 91618-36-9.